C14H24N2O2 — CID 99790031
(2S)-4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]morpholine-2-carboxamide (PubChem CID 99790031) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is (2S)-4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]morpholine-2-carboxamide.
| Compound Name | (2S)-4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 99790031 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | (2S)-4-[[(1R,6S)-2,6-dimethylcyclohex-2-en-1-yl]methyl]morpholine-2-carboxamide |
| SMILES | CC1=CCC[C@H](C)[C@H]1CN1CCO[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C14H24N2O2/c1-10-4-3-5-11(2)12(10)8-16-6-7-18-13(9-16)14(15)17/h4,11-13H,3,5-9H2,1-2H3,(H2,15,17)/t11-,12-,13-/m0/s1 |
| InChIKey | NPDGOOAUTQYALC-AVGNSLFASA-N |
| XLogP | 1.16 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|