C14H27NO2S — CID 86799420
N-[(2,6-dimethylcyclohex-2-en-1-yl)methyl]-1-ethylsulfonylpropan-2-amine (PubChem CID 86799420) has the molecular formula C14H27NO2S and a molecular weight of 273.44 g/mol. Its IUPAC name is N-[(2,6-dimethylcyclohex-2-en-1-yl)methyl]-1-ethylsulfonylpropan-2-amine.
| Compound Name | N-[(2,6-dimethylcyclohex-2-en-1-yl)methyl]-1-ethylsulfonylpropan-2-amine |
|---|---|
| PubChem CID | 86799420 |
| Molecular Formula | C14H27NO2S |
| Molecular Weight | 273.44 g/mol |
| Exact Mass | 273.18 |
| IUPAC Name | N-[(2,6-dimethylcyclohex-2-en-1-yl)methyl]-1-ethylsulfonylpropan-2-amine |
| SMILES | CCS(=O)(=O)CC(C)NCC1C(C)=CCCC1C |
| InChI | InChI=1S/C14H27NO2S/c1-5-18(16,17)10-13(4)15-9-14-11(2)7-6-8-12(14)3/h7,12-15H,5-6,8-10H2,1-4H3 |
| InChIKey | ZOOUVSKRFQAJOJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|