C14H14N2O5 — CID 99864999
(5S,7aR)-2-(4-methoxyphenyl)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-5-carboxylic acid (PubChem CID 99864999) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is (5S,7aR)-2-(4-methoxyphenyl)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-5-carboxylic acid.
| Compound Name | (5S,7aR)-2-(4-methoxyphenyl)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-5-carboxylic acid |
|---|---|
| PubChem CID | 99864999 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (5S,7aR)-2-(4-methoxyphenyl)-1,3-dioxo-5,6,7,7a-tetrahydropyrrolo[1,2-c]imidazole-5-carboxylic acid |
| SMILES | COc1ccc(N2C(=O)[C@H]3CC[C@@H](C(=O)O)N3C2=O)cc1 |
| InChI | InChI=1S/C14H14N2O5/c1-21-9-4-2-8(3-5-9)15-12(17)10-6-7-11(13(18)19)16(10)14(15)20/h2-5,10-11H,6-7H2,1H3,(H,18,19)/t10-,11+/m1/s1 |
| InChIKey | YOIMNLXSZIOIAT-MNOVXSKESA-N |
| XLogP | 1.08 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|