C19H21N3O3 — CID 99875955
(1S)-N-[1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]pyrazol-4-yl]cyclohex-3-ene-1-carboxamide (PubChem CID 99875955) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is (1S)-N-[1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]pyrazol-4-yl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1S)-N-[1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]pyrazol-4-yl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 99875955 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (1S)-N-[1-[[(3R)-2,3-dihydro-1,4-benzodioxin-3-yl]methyl]pyrazol-4-yl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(Nc1cnn(C[C@@H]2COc3ccccc3O2)c1)[C@@H]1CC=CCC1 |
| InChI | InChI=1S/C19H21N3O3/c23-19(14-6-2-1-3-7-14)21-15-10-20-22(11-15)12-16-13-24-17-8-4-5-9-18(17)25-16/h1-2,4-5,8-11,14,16H,3,6-7,12-13H2,(H,21,23)/t14-,16-/m1/s1 |
| InChIKey | SDJJCCDYRUQWRG-GDBMZVCRSA-N |
| XLogP | 3.02 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|