C22H25NO3S — CID 99884092
(E)-3-(3,4-dimethoxyphenyl)-1-[(7S)-7-phenyl-1,4-thiazepan-4-yl]prop-2-en-1-one (PubChem CID 99884092) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[(7S)-7-phenyl-1,4-thiazepan-4-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[(7S)-7-phenyl-1,4-thiazepan-4-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 99884092 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[(7S)-7-phenyl-1,4-thiazepan-4-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCS[C@H](c3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C22H25NO3S/c1-25-19-10-8-17(16-20(19)26-2)9-11-22(24)23-13-12-21(27-15-14-23)18-6-4-3-5-7-18/h3-11,16,21H,12-15H2,1-2H3/b11-9+/t21-/m0/s1 |
| InChIKey | PHSPIOUMMPJENY-ZUURVNMSSA-N |
| XLogP | 4.42 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|