C20H32BN3O3S — CID 99884279
1-[(3S)-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpropyl]piperidin-1-yl]ethanone (PubChem CID 99884279) has the molecular formula C20H32BN3O3S and a molecular weight of 405.37 g/mol. Its IUPAC name is 1-[(3S)-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpropyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[(3S)-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpropyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 99884279 |
| Molecular Formula | C20H32BN3O3S |
| Molecular Weight | 405.37 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-[(3S)-3-[3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]sulfanylpropyl]piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC[C@@H](CCCSc2ncc(B3OC(C)(C)C(C)(C)O3)cn2)C1 |
| InChI | InChI=1S/C20H32BN3O3S/c1-15(25)24-10-6-8-16(14-24)9-7-11-28-18-22-12-17(13-23-18)21-26-19(2,3)20(4,5)27-21/h12-13,16H,6-11,14H2,1-5H3/t16-/m0/s1 |
| InChIKey | MJKAFBCPURINMN-INIZCTEOSA-N |
| XLogP | 2.91 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|