C12H17N5O5 — CID 99902227
2-[[2-[[(Z)-2-cyano-1-(methylcarbamoylamino)-1-oxopent-2-en-3-yl]amino]acetyl]amino]acetic acid (PubChem CID 99902227) has the molecular formula C12H17N5O5 and a molecular weight of 311.30 g/mol. Its IUPAC name is 2-[[2-[[(Z)-2-cyano-1-(methylcarbamoylamino)-1-oxopent-2-en-3-yl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(Z)-2-cyano-1-(methylcarbamoylamino)-1-oxopent-2-en-3-yl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 99902227 |
| Molecular Formula | C12H17N5O5 |
| Molecular Weight | 311.30 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-[[2-[[(Z)-2-cyano-1-(methylcarbamoylamino)-1-oxopent-2-en-3-yl]amino]acetyl]amino]acetic acid |
| SMILES | CC/C(NCC(=O)NCC(=O)O)=C(\C#N)C(=O)NC(=O)NC |
| InChI | InChI=1S/C12H17N5O5/c1-3-8(15-5-9(18)16-6-10(19)20)7(4-13)11(21)17-12(22)14-2/h15H,3,5-6H2,1-2H3,(H,16,18)(H,19,20)(H2,14,17,21,22)/b8-7- |
| InChIKey | UJSSOUWTRISXRQ-FPLPWBNLSA-N |
| XLogP | -1.58 |
| TPSA | 160.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.30 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|