C18H20F2N4O — CID 99931768
(2S)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-methyl-3-pyrazol-1-ylpropanamide (PubChem CID 99931768) has the molecular formula C18H20F2N4O and a molecular weight of 346.38 g/mol. Its IUPAC name is (2S)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-methyl-3-pyrazol-1-ylpropanamide.
| Compound Name | (2S)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-methyl-3-pyrazol-1-ylpropanamide |
|---|---|
| PubChem CID | 99931768 |
| Molecular Formula | C18H20F2N4O |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | (2S)-N-[2-(5,7-difluoro-2-methyl-1H-indol-3-yl)ethyl]-2-methyl-3-pyrazol-1-ylpropanamide |
| SMILES | Cc1[nH]c2c(F)cc(F)cc2c1CCNC(=O)[C@@H](C)Cn1cccn1 |
| InChI | InChI=1S/C18H20F2N4O/c1-11(10-24-7-3-5-22-24)18(25)21-6-4-14-12(2)23-17-15(14)8-13(19)9-16(17)20/h3,5,7-9,11,23H,4,6,10H2,1-2H3,(H,21,25)/t11-/m0/s1 |
| InChIKey | AYYDKJUAJAWJQU-NSHDSACASA-N |
| XLogP | 2.95 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|