C19H19BF2N2 — CID 99938508
[2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-phenylmethyl]-3,5-dimethylpyrrol-1-yl]-difluoroborane (PubChem CID 99938508) has the molecular formula C19H19BF2N2 and a molecular weight of 324.18 g/mol. Its IUPAC name is [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-phenylmethyl]-3,5-dimethylpyrrol-1-yl]-difluoroborane.
| Compound Name | [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-phenylmethyl]-3,5-dimethylpyrrol-1-yl]-difluoroborane |
|---|---|
| PubChem CID | 99938508 |
| Molecular Formula | C19H19BF2N2 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [2-[(Z)-(3,5-dimethylpyrrol-2-ylidene)-phenylmethyl]-3,5-dimethylpyrrol-1-yl]-difluoroborane |
| SMILES | CC1=CC(C)=N/C1=C(/c1ccccc1)c1c(C)cc(C)n1B(F)F |
| InChI | InChI=1S/C19H19BF2N2/c1-12-10-14(3)23-18(12)17(16-8-6-5-7-9-16)19-13(2)11-15(4)24(19)20(21)22/h5-11H,1-4H3/b18-17- |
| InChIKey | CMLQGCANJGWRFY-ZCXUNETKSA-N |
| XLogP | 5.06 |
| TPSA | 17.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|