C17H23N3O3 — CID 99941060
benzyl (2R,3aS,7aR)-6-(methylcarbamoyl)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-2-carboxylate (PubChem CID 99941060) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is benzyl (2R,3aS,7aR)-6-(methylcarbamoyl)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-2-carboxylate.
| Compound Name | benzyl (2R,3aS,7aR)-6-(methylcarbamoyl)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 99941060 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | benzyl (2R,3aS,7aR)-6-(methylcarbamoyl)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-2-carboxylate |
| SMILES | CNC(=O)N1CC[C@H]2C[C@H](C(=O)OCc3ccccc3)N[C@H]2C1 |
| InChI | InChI=1S/C17H23N3O3/c1-18-17(22)20-8-7-13-9-14(19-15(13)10-20)16(21)23-11-12-5-3-2-4-6-12/h2-6,13-15,19H,7-11H2,1H3,(H,18,22)/t13-,14+,15-/m0/s1 |
| InChIKey | STSKUIKMISZJRU-ZNMIVQPWSA-N |
| XLogP | 1.12 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |