C15H20N4O2 — CID 154499629
6-N-phenyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-2,6-dicarboxamide (PubChem CID 154499629) has the molecular formula C15H20N4O2 and a molecular weight of 288.35 g/mol. Its IUPAC name is 6-N-phenyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-2,6-dicarboxamide.
| Compound Name | 6-N-phenyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 154499629 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 6-N-phenyl-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridine-2,6-dicarboxamide |
| SMILES | NC(=O)C1CC2CCN(C(=O)Nc3ccccc3)CC2N1 |
| InChI | InChI=1S/C15H20N4O2/c16-14(20)12-8-10-6-7-19(9-13(10)18-12)15(21)17-11-4-2-1-3-5-11/h1-5,10,12-13,18H,6-9H2,(H2,16,20)(H,17,21) |
| InChIKey | VFTZDCWOPPGLDE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |