C14H12ClN5O4 — CID 99955993
N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-[(4S)-2,5-dioxoimidazolidin-4-yl]acetamide (PubChem CID 99955993) has the molecular formula C14H12ClN5O4 and a molecular weight of 349.73 g/mol. Its IUPAC name is N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-[(4S)-2,5-dioxoimidazolidin-4-yl]acetamide.
| Compound Name | N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-[(4S)-2,5-dioxoimidazolidin-4-yl]acetamide |
|---|---|
| PubChem CID | 99955993 |
| Molecular Formula | C14H12ClN5O4 |
| Molecular Weight | 349.73 g/mol |
| Exact Mass | 349.06 |
| IUPAC Name | N-[[3-(2-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-2-[(4S)-2,5-dioxoimidazolidin-4-yl]acetamide |
| SMILES | O=C(C[C@@H]1NC(=O)NC1=O)NCc1nc(-c2ccccc2Cl)no1 |
| InChI | InChI=1S/C14H12ClN5O4/c15-8-4-2-1-3-7(8)12-18-11(24-20-12)6-16-10(21)5-9-13(22)19-14(23)17-9/h1-4,9H,5-6H2,(H,16,21)(H2,17,19,22,23)/t9-/m0/s1 |
| InChIKey | VWIYUXDJJIBLBY-VIFPVBQESA-N |
| XLogP | 0.60 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.73 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|