C16H23N5O — CID 99971868
N-[(1S)-1-(5-methyl-1H-imidazol-2-yl)propyl]-2-[methyl(pyridin-3-ylmethyl)amino]acetamide (PubChem CID 99971868) has the molecular formula C16H23N5O and a molecular weight of 301.39 g/mol. Its IUPAC name is N-[(1S)-1-(5-methyl-1H-imidazol-2-yl)propyl]-2-[methyl(pyridin-3-ylmethyl)amino]acetamide.
| Compound Name | N-[(1S)-1-(5-methyl-1H-imidazol-2-yl)propyl]-2-[methyl(pyridin-3-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 99971868 |
| Molecular Formula | C16H23N5O |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.19 |
| IUPAC Name | N-[(1S)-1-(5-methyl-1H-imidazol-2-yl)propyl]-2-[methyl(pyridin-3-ylmethyl)amino]acetamide |
| SMILES | CC[C@H](NC(=O)CN(C)Cc1cccnc1)c1ncc(C)[nH]1 |
| InChI | InChI=1S/C16H23N5O/c1-4-14(16-18-8-12(2)19-16)20-15(22)11-21(3)10-13-6-5-7-17-9-13/h5-9,14H,4,10-11H2,1-3H3,(H,18,19)(H,20,22)/t14-/m0/s1 |
| InChIKey | DVKRGYVXTLKMJY-AWEZNQCLSA-N |
| XLogP | 1.81 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |