C15H21N2O+ — CID 99979179
(1R,9S,10R)-14-methyl-7-aza-14-azoniatetracyclo[7.6.1.02,7.010,14]hexadeca-2,4-dien-6-one (PubChem CID 99979179) has the molecular formula C15H21N2O+ and a molecular weight of 245.35 g/mol. Its IUPAC name is (1R,9S,10R)-14-methyl-7-aza-14-azoniatetracyclo[7.6.1.02,7.010,14]hexadeca-2,4-dien-6-one.
| Compound Name | (1R,9S,10R)-14-methyl-7-aza-14-azoniatetracyclo[7.6.1.02,7.010,14]hexadeca-2,4-dien-6-one |
|---|---|
| PubChem CID | 99979179 |
| Molecular Formula | C15H21N2O+ |
| Molecular Weight | 245.35 g/mol |
| Exact Mass | 245.16 |
| IUPAC Name | (1R,9S,10R)-14-methyl-7-aza-14-azoniatetracyclo[7.6.1.02,7.010,14]hexadeca-2,4-dien-6-one |
| SMILES | C[N+]12CCC[C@@H]1[C@H]1C[C@H](C2)c2cccc(=O)n2C1 |
| InChI | InChI=1S/C15H21N2O/c1-17-7-3-5-14(17)11-8-12(10-17)13-4-2-6-15(18)16(13)9-11/h2,4,6,11-12,14H,3,5,7-10H2,1H3/q+1/t11-,12+,14+,17?/m0/s1 |
| InChIKey | PDBKVEXJATVUPI-PBLDKRBDSA-N |
| XLogP | 1.57 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|