C13H17ClN2O3 — CID 99991938
2-(3-chloro-4-hydroxyphenyl)-N-[[(3S)-3-hydroxypyrrolidin-3-yl]methyl]acetamide (PubChem CID 99991938) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is 2-(3-chloro-4-hydroxyphenyl)-N-[[(3S)-3-hydroxypyrrolidin-3-yl]methyl]acetamide.
| Compound Name | 2-(3-chloro-4-hydroxyphenyl)-N-[[(3S)-3-hydroxypyrrolidin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 99991938 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | 2-(3-chloro-4-hydroxyphenyl)-N-[[(3S)-3-hydroxypyrrolidin-3-yl]methyl]acetamide |
| SMILES | O=C(Cc1ccc(O)c(Cl)c1)NC[C@]1(O)CCNC1 |
| InChI | InChI=1S/C13H17ClN2O3/c14-10-5-9(1-2-11(10)17)6-12(18)16-8-13(19)3-4-15-7-13/h1-2,5,15,17,19H,3-4,6-8H2,(H,16,18)/t13-/m0/s1 |
| InChIKey | OLZZEKCWTAJWRH-ZDUSSCGKSA-N |
| XLogP | 0.43 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |