C16H17F3O4 — CID 99992666
ethyl (2S)-2-propoxy-2-(trifluoromethyl)chromene-3-carboxylate (PubChem CID 99992666) has the molecular formula C16H17F3O4 and a molecular weight of 330.30 g/mol. Its IUPAC name is ethyl (2S)-2-propoxy-2-(trifluoromethyl)chromene-3-carboxylate.
| Compound Name | ethyl (2S)-2-propoxy-2-(trifluoromethyl)chromene-3-carboxylate |
|---|---|
| PubChem CID | 99992666 |
| Molecular Formula | C16H17F3O4 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | ethyl (2S)-2-propoxy-2-(trifluoromethyl)chromene-3-carboxylate |
| SMILES | CCCO[C@]1(C(F)(F)F)Oc2ccccc2C=C1C(=O)OCC |
| InChI | InChI=1S/C16H17F3O4/c1-3-9-22-15(16(17,18)19)12(14(20)21-4-2)10-11-7-5-6-8-13(11)23-15/h5-8,10H,3-4,9H2,1-2H3/t15-/m0/s1 |
| InChIKey | KGBBUMKGHMQKNO-HNNXBMFYSA-N |
| XLogP | 3.71 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |