C18H23NO — CID 19142
View drug profile → moxastine2-(1,1-diphenylethoxy)-N,N-dimethylethanamine (PubChem CID 19142) has the molecular formula C18H23NO and a molecular weight of 269.39 g/mol. Its IUPAC name is 2-(1,1-diphenylethoxy)-N,N-dimethylethanamine.
| Compound Name | 2-(1,1-diphenylethoxy)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 19142 |
| Molecular Formula | C18H23NO |
| Molecular Weight | 269.39 g/mol |
| Exact Mass | 269.18 |
| IUPAC Name | 2-(1,1-diphenylethoxy)-N,N-dimethylethanamine |
| SMILES | CN(C)CCOC(C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H23NO/c1-18(20-15-14-19(2)3,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,14-15H2,1-3H3 |
| InChIKey | BBIMHFSPNXQFAH-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |