C4H6N4O3 — CID 204
View drug profile → allantoin(2,5-dioxoimidazolidin-4-yl)urea (PubChem CID 204) has the molecular formula C4H6N4O3 and a molecular weight of 158.12 g/mol. Its IUPAC name is (2,5-dioxoimidazolidin-4-yl)urea.
| Compound Name | (2,5-dioxoimidazolidin-4-yl)urea |
|---|---|
| PubChem CID | 204 |
| Molecular Formula | C4H6N4O3 |
| Molecular Weight | 158.12 g/mol |
| Exact Mass | 158.04 |
| IUPAC Name | (2,5-dioxoimidazolidin-4-yl)urea |
| SMILES | NC(=O)NC1NC(=O)NC1=O |
| InChI | InChI=1S/C4H6N4O3/c5-3(10)6-1-2(9)8-4(11)7-1/h1H,(H3,5,6,10)(H2,7,8,9,11) |
| InChIKey | POJWUDADGALRAB-UHFFFAOYSA-N |
| XLogP | -2.18 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.12 |
| LogP ≤ 5 | -2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|