C9H10N2O — CID 16630
View drug profile → aminorex5-phenyl-4,5-dihydro-1,3-oxazol-2-amine (PubChem CID 16630) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 5-phenyl-4,5-dihydro-1,3-oxazol-2-amine.
| Compound Name | 5-phenyl-4,5-dihydro-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 16630 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 5-phenyl-4,5-dihydro-1,3-oxazol-2-amine |
| SMILES | NC1=NCC(c2ccccc2)O1 |
| InChI | InChI=1S/C9H10N2O/c10-9-11-6-8(12-9)7-4-2-1-3-5-7/h1-5,8H,6H2,(H2,10,11) |
| InChIKey | SYAKTDIEAPMBAL-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |