About (4-acetamidophenyl) 2-acetyloxybenzoate
(4-acetamidophenyl) 2-acetyloxybenzoate (PubChem CID 21102) has the molecular formula C17H15NO5
and a molecular weight of 313.31 g/mol. Its IUPAC name is (4-acetamidophenyl) 2-acetyloxybenzoate.
Molecular Properties
| Compound Name | (4-acetamidophenyl) 2-acetyloxybenzoate |
| PubChem CID | 21102 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | (4-acetamidophenyl) 2-acetyloxybenzoate |
| SMILES | CC(=O)Nc1ccc(OC(=O)c2ccccc2OC(C)=O)cc1 |
| InChI | InChI=1S/C17H15NO5/c1-11(19)18-13-7-9-14(10-8-13)23-17(21)15-5-3-4-6-16(15)22-12(2)20/h3-10H,1-2H3,(H,18,19) |
| InChIKey | FEJKLNWAOXSSNR-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-acetamidophenyl) 2-acetyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-acetamidophenyl) 2-acetyloxybenzoate?
The IUPAC name of (4-acetamidophenyl) 2-acetyloxybenzoate (CID 21102) is (4-acetamidophenyl) 2-acetyloxybenzoate.
What is the SMILES notation for (4-acetamidophenyl) 2-acetyloxybenzoate?
The canonical SMILES for (4-acetamidophenyl) 2-acetyloxybenzoate is CC(=O)Nc1ccc(OC(=O)c2ccccc2OC(C)=O)cc1.
What is the InChIKey of (4-acetamidophenyl) 2-acetyloxybenzoate?
The InChIKey is FEJKLNWAOXSSNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15NO5/c1-11(19)18-13-7-9-14(10-8-13)23-17(21)15-5-3-4-6-16(15)22-12(2)20/h3-10H,1-2H3,(H,18,19).
What are the key properties of (4-acetamidophenyl) 2-acetyloxybenzoate?
(4-acetamidophenyl) 2-acetyloxybenzoate has a molecular weight of 313.31 g/mol, XLogP of 2.79, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) 2-acetyloxybenzoate is sourced from PubChem (CID 21102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).