C17H22N2 — CID 9423
View drug profile → bucricaineN-butyl-1,2,3,4-tetrahydroacridin-9-amine (PubChem CID 9423) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-butyl-1,2,3,4-tetrahydroacridin-9-amine.
| Compound Name | N-butyl-1,2,3,4-tetrahydroacridin-9-amine |
|---|---|
| PubChem CID | 9423 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-butyl-1,2,3,4-tetrahydroacridin-9-amine |
| SMILES | CCCCNc1c2c(nc3ccccc13)CCCC2 |
| InChI | InChI=1S/C17H22N2/c1-2-3-12-18-17-13-8-4-6-10-15(13)19-16-11-7-5-9-14(16)17/h4,6,8,10H,2-3,5,7,9,11-12H2,1H3,(H,18,19) |
| InChIKey | ZFPNOTAGQWNERF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|