About naphthalen-1-yl N-methylcarbamate
naphthalen-1-yl N-methylcarbamate (PubChem CID 6129) has the molecular formula C12H11NO2
and a molecular weight of 201.22 g/mol. Its IUPAC name is naphthalen-1-yl N-methylcarbamate.
Molecular Properties
| Compound Name | naphthalen-1-yl N-methylcarbamate |
| PubChem CID | 6129 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | naphthalen-1-yl N-methylcarbamate |
| SMILES | CNC(=O)Oc1cccc2ccccc12 |
| InChI | InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) |
| InChIKey | CVXBEEMKQHEXEN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze naphthalen-1-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalen-1-yl N-methylcarbamate?
The IUPAC name of naphthalen-1-yl N-methylcarbamate (CID 6129) is naphthalen-1-yl N-methylcarbamate.
What is the SMILES notation for naphthalen-1-yl N-methylcarbamate?
The canonical SMILES for naphthalen-1-yl N-methylcarbamate is CNC(=O)Oc1cccc2ccccc12.
What is the InChIKey of naphthalen-1-yl N-methylcarbamate?
The InChIKey is CVXBEEMKQHEXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14).
What are the key properties of naphthalen-1-yl N-methylcarbamate?
naphthalen-1-yl N-methylcarbamate has a molecular weight of 201.22 g/mol, XLogP of 2.56, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalen-1-yl N-methylcarbamate is sourced from PubChem (CID 6129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).