C11H16FN3O3 — CID 2577
View drug profile → carmofur5-fluoro-N-hexyl-2,4-dioxopyrimidine-1-carboxamide (PubChem CID 2577) has the molecular formula C11H16FN3O3 and a molecular weight of 257.26 g/mol. Its IUPAC name is 5-fluoro-N-hexyl-2,4-dioxopyrimidine-1-carboxamide.
| Compound Name | 5-fluoro-N-hexyl-2,4-dioxopyrimidine-1-carboxamide |
|---|---|
| PubChem CID | 2577 |
| Molecular Formula | C11H16FN3O3 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 5-fluoro-N-hexyl-2,4-dioxopyrimidine-1-carboxamide |
| SMILES | CCCCCCNC(=O)n1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16FN3O3/c1-2-3-4-5-6-13-10(17)15-7-8(12)9(16)14-11(15)18/h7H,2-6H2,1H3,(H,13,17)(H,14,16,18) |
| InChIKey | AOCCBINRVIKJHY-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|