C18H18ClNS — CID 667467
View drug profile → chlorprothixene(3Z)-3-(2-chlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine (PubChem CID 667467) has the molecular formula C18H18ClNS and a molecular weight of 315.87 g/mol. Its IUPAC name is (3Z)-3-(2-chlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine.
| Compound Name | (3Z)-3-(2-chlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 667467 |
| Molecular Formula | C18H18ClNS |
| Molecular Weight | 315.87 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | (3Z)-3-(2-chlorothioxanthen-9-ylidene)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CC/C=C1/c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H18ClNS/c1-20(2)11-5-7-14-15-6-3-4-8-17(15)21-18-10-9-13(19)12-16(14)18/h3-4,6-10,12H,5,11H2,1-2H3/b14-7- |
| InChIKey | WSPOMRSOLSGNFJ-AUWJEWJLSA-N |
| XLogP | 5.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.87 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|