C10H9I3O3 — CID 11127
View drug profile → phenobutiodil2-(2,4,6-triiodophenoxy)butanoic acid (PubChem CID 11127) has the molecular formula C10H9I3O3 and a molecular weight of 557.89 g/mol. Its IUPAC name is 2-(2,4,6-triiodophenoxy)butanoic acid.
| Compound Name | 2-(2,4,6-triiodophenoxy)butanoic acid |
|---|---|
| PubChem CID | 11127 |
| Molecular Formula | C10H9I3O3 |
| Molecular Weight | 557.89 g/mol |
| Exact Mass | 557.77 |
| IUPAC Name | 2-(2,4,6-triiodophenoxy)butanoic acid |
| SMILES | CCC(Oc1c(I)cc(I)cc1I)C(=O)O |
| InChI | InChI=1S/C10H9I3O3/c1-2-8(10(14)15)16-9-6(12)3-5(11)4-7(9)13/h3-4,8H,2H2,1H3,(H,14,15) |
| InChIKey | VYAGDYWTCWDKIS-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|