C18H21ClN2 — CID 21382
View drug profile → clomacran3-(2-chloro-9,10-dihydroacridin-9-yl)-N,N-dimethylpropan-1-amine (PubChem CID 21382) has the molecular formula C18H21ClN2 and a molecular weight of 300.83 g/mol. Its IUPAC name is 3-(2-chloro-9,10-dihydroacridin-9-yl)-N,N-dimethylpropan-1-amine.
| Compound Name | 3-(2-chloro-9,10-dihydroacridin-9-yl)-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 21382 |
| Molecular Formula | C18H21ClN2 |
| Molecular Weight | 300.83 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 3-(2-chloro-9,10-dihydroacridin-9-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCC1c2ccccc2Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C18H21ClN2/c1-21(2)11-5-7-14-15-6-3-4-8-17(15)20-18-10-9-13(19)12-16(14)18/h3-4,6,8-10,12,14,20H,5,7,11H2,1-2H3 |
| InChIKey | JFRLWWDJCFYFSU-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.83 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |