About 4-decoxy-3,5-dimethoxybenzamide
4-decoxy-3,5-dimethoxybenzamide (PubChem CID 26929) has the molecular formula C19H31NO4
and a molecular weight of 337.46 g/mol. Its IUPAC name is 4-decoxy-3,5-dimethoxybenzamide.
Molecular Properties
| Compound Name | 4-decoxy-3,5-dimethoxybenzamide |
| PubChem CID | 26929 |
| Molecular Formula | C19H31NO4 |
| Molecular Weight | 337.46 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 4-decoxy-3,5-dimethoxybenzamide |
| SMILES | CCCCCCCCCCOc1c(OC)cc(C(N)=O)cc1OC |
| InChI | InChI=1S/C19H31NO4/c1-4-5-6-7-8-9-10-11-12-24-18-16(22-2)13-15(19(20)21)14-17(18)23-3/h13-14H,4-12H2,1-3H3,(H2,20,21) |
| InChIKey | REYUZOLYIOQRIG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-decoxy-3,5-dimethoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decoxy-3,5-dimethoxybenzamide?
The IUPAC name of 4-decoxy-3,5-dimethoxybenzamide (CID 26929) is 4-decoxy-3,5-dimethoxybenzamide.
What is the SMILES notation for 4-decoxy-3,5-dimethoxybenzamide?
The canonical SMILES for 4-decoxy-3,5-dimethoxybenzamide is CCCCCCCCCCOc1c(OC)cc(C(N)=O)cc1OC.
What is the InChIKey of 4-decoxy-3,5-dimethoxybenzamide?
The InChIKey is REYUZOLYIOQRIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H31NO4/c1-4-5-6-7-8-9-10-11-12-24-18-16(22-2)13-15(19(20)21)14-17(18)23-3/h13-14H,4-12H2,1-3H3,(H2,20,21).
What are the key properties of 4-decoxy-3,5-dimethoxybenzamide?
4-decoxy-3,5-dimethoxybenzamide has a molecular weight of 337.46 g/mol, XLogP of 4.32, 13 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decoxy-3,5-dimethoxybenzamide is sourced from PubChem (CID 26929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).