C6H12O7 — CID 10690
View drug profile → gluconic acid(2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid (PubChem CID 10690) has the molecular formula C6H12O7 and a molecular weight of 196.16 g/mol. Its IUPAC name is (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid.
| Compound Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
|---|---|
| PubChem CID | 10690 |
| Molecular Formula | C6H12O7 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | (2R,3S,4R,5R)-2,3,4,5,6-pentahydroxyhexanoic acid |
| SMILES | O=C(O)[C@H](O)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C6H12O7/c7-1-2(8)3(9)4(10)5(11)6(12)13/h2-5,7-11H,1H2,(H,12,13)/t2-,3-,4+,5-/m1/s1 |
| InChIKey | RGHNJXZEOKUKBD-SQOUGZDYSA-N |
| XLogP | -3.49 |
| TPSA | 138.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -3.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |