C10H14N4O4 — CID 3182
View drug profile → diprophylline7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione (PubChem CID 3182) has the molecular formula C10H14N4O4 and a molecular weight of 254.25 g/mol. Its IUPAC name is 7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione.
| Compound Name | 7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 3182 |
| Molecular Formula | C10H14N4O4 |
| Molecular Weight | 254.25 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 7-(2,3-dihydroxypropyl)-1,3-dimethylpurine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CC(O)CO)n(C)c1=O |
| InChI | InChI=1S/C10H14N4O4/c1-12-8-7(9(17)13(2)10(12)18)14(5-11-8)3-6(16)4-15/h5-6,15-16H,3-4H2,1-2H3 |
| InChIKey | KSCFJBIXMNOVSH-UHFFFAOYSA-N |
| XLogP | -2.21 |
| TPSA | 102.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.25 |
| LogP ≤ 5 | -2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |