C24H31NO — CID 13331
View drug profile → dipipanone4,4-diphenyl-6-piperidin-1-ylheptan-3-one (PubChem CID 13331) has the molecular formula C24H31NO and a molecular weight of 349.52 g/mol. Its IUPAC name is 4,4-diphenyl-6-piperidin-1-ylheptan-3-one.
| Compound Name | 4,4-diphenyl-6-piperidin-1-ylheptan-3-one |
|---|---|
| PubChem CID | 13331 |
| Molecular Formula | C24H31NO |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.24 |
| IUPAC Name | 4,4-diphenyl-6-piperidin-1-ylheptan-3-one |
| SMILES | CCC(=O)C(CC(C)N1CCCCC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H31NO/c1-3-23(26)24(21-13-7-4-8-14-21,22-15-9-5-10-16-22)19-20(2)25-17-11-6-12-18-25/h4-5,7-10,13-16,20H,3,6,11-12,17-19H2,1-2H3 |
| InChIKey | SVDHSZFEQYXRDC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |