2,5-diamino-2-(difluoromethyl)pentanoic acid

C6H12F2N2O2 — CID 3009

💊View drug profile → eflornithine
IUPAC2,5-diamino-2-(difluoromethyl)pentanoic acid
SMILESNCCCC(N)(C(=O)O)C(F)F
InChIInChI=1S/C6H12F2N2O2/c7-4(8)6(10,5(11)12)2-1-3-9/h4H,1-3,9-10H2,(H,11,12)
InChIKeyVLCYCQAOQCDTCN-UHFFFAOYSA-N
MW182.17 g/mol
LogP-0.23
Rot. Bonds5

About 2,5-diamino-2-(difluoromethyl)pentanoic acid

2,5-diamino-2-(difluoromethyl)pentanoic acid (PubChem CID 3009) has the molecular formula C6H12F2N2O2 and a molecular weight of 182.17 g/mol. Its IUPAC name is 2,5-diamino-2-(difluoromethyl)pentanoic acid.

Molecular Properties

Compound Name2,5-diamino-2-(difluoromethyl)pentanoic acid
PubChem CID3009
Molecular FormulaC6H12F2N2O2
Molecular Weight182.17 g/mol
Exact Mass182.09
IUPAC Name2,5-diamino-2-(difluoromethyl)pentanoic acid
SMILESNCCCC(N)(C(=O)O)C(F)F
InChIInChI=1S/C6H12F2N2O2/c7-4(8)6(10,5(11)12)2-1-3-9/h4H,1-3,9-10H2,(H,11,12)
InChIKeyVLCYCQAOQCDTCN-UHFFFAOYSA-N
XLogP-0.23
TPSA89.34 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.17
LogP ≤ 5-0.23
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2,5-diamino-2-(difluoromethyl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,5-diamino-2-(difluoromethyl)pentanoic acid?
The IUPAC name of 2,5-diamino-2-(difluoromethyl)pentanoic acid (CID 3009) is 2,5-diamino-2-(difluoromethyl)pentanoic acid.
What is the SMILES notation for 2,5-diamino-2-(difluoromethyl)pentanoic acid?
The canonical SMILES for 2,5-diamino-2-(difluoromethyl)pentanoic acid is NCCCC(N)(C(=O)O)C(F)F.
What is the InChIKey of 2,5-diamino-2-(difluoromethyl)pentanoic acid?
The InChIKey is VLCYCQAOQCDTCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12F2N2O2/c7-4(8)6(10,5(11)12)2-1-3-9/h4H,1-3,9-10H2,(H,11,12).
What are the key properties of 2,5-diamino-2-(difluoromethyl)pentanoic acid?
2,5-diamino-2-(difluoromethyl)pentanoic acid has a molecular weight of 182.17 g/mol, XLogP of -0.23, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diamino-2-(difluoromethyl)pentanoic acid is sourced from PubChem (CID 3009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).