C9H10O4 — CID 3362
View drug profile → flopropione1-(2,4,6-trihydroxyphenyl)propan-1-one (PubChem CID 3362) has the molecular formula C9H10O4 and a molecular weight of 182.17 g/mol. Its IUPAC name is 1-(2,4,6-trihydroxyphenyl)propan-1-one.
| Compound Name | 1-(2,4,6-trihydroxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 3362 |
| Molecular Formula | C9H10O4 |
| Molecular Weight | 182.17 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | 1-(2,4,6-trihydroxyphenyl)propan-1-one |
| SMILES | CCC(=O)c1c(O)cc(O)cc1O |
| InChI | InChI=1S/C9H10O4/c1-2-6(11)9-7(12)3-5(10)4-8(9)13/h3-4,10,12-13H,2H2,1H3 |
| InChIKey | PTHLEKANMPKYDB-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.17 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |