C10H16N2OS — CID 3032361
View drug profile → albutoin5-(2-methylpropyl)-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-one (PubChem CID 3032361) has the molecular formula C10H16N2OS and a molecular weight of 212.32 g/mol. Its IUPAC name is 5-(2-methylpropyl)-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-one.
| Compound Name | 5-(2-methylpropyl)-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-one |
|---|---|
| PubChem CID | 3032361 |
| Molecular Formula | C10H16N2OS |
| Molecular Weight | 212.32 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 5-(2-methylpropyl)-3-prop-2-enyl-2-sulfanylideneimidazolidin-4-one |
| SMILES | C=CCN1C(=O)C(CC(C)C)NC1=S |
| InChI | InChI=1S/C10H16N2OS/c1-4-5-12-9(13)8(6-7(2)3)11-10(12)14/h4,7-8H,1,5-6H2,2-3H3,(H,11,14) |
| InChIKey | RATGSRSDPNECNO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|