C19H18N2O3 — CID 3824
View drug profile → kebuzone4-(3-oxobutyl)-1,2-diphenylpyrazolidine-3,5-dione (PubChem CID 3824) has the molecular formula C19H18N2O3 and a molecular weight of 322.36 g/mol. Its IUPAC name is 4-(3-oxobutyl)-1,2-diphenylpyrazolidine-3,5-dione.
| Compound Name | 4-(3-oxobutyl)-1,2-diphenylpyrazolidine-3,5-dione |
|---|---|
| PubChem CID | 3824 |
| Molecular Formula | C19H18N2O3 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 4-(3-oxobutyl)-1,2-diphenylpyrazolidine-3,5-dione |
| SMILES | CC(=O)CCC1C(=O)N(c2ccccc2)N(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H18N2O3/c1-14(22)12-13-17-18(23)20(15-8-4-2-5-9-15)21(19(17)24)16-10-6-3-7-11-16/h2-11,17H,12-13H2,1H3 |
| InChIKey | LGYTZKPVOAIUKX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_B(12)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|