C5H10N2O3 — CID 5961
View drug profile → glutamine(2S)-2,5-diamino-5-oxopentanoic acid (PubChem CID 5961) has the molecular formula C5H10N2O3 and a molecular weight of 146.15 g/mol. Its IUPAC name is (2S)-2,5-diamino-5-oxopentanoic acid.
| Compound Name | (2S)-2,5-diamino-5-oxopentanoic acid |
|---|---|
| PubChem CID | 5961 |
| Molecular Formula | C5H10N2O3 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.07 |
| IUPAC Name | (2S)-2,5-diamino-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C5H10N2O3/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H2,7,8)(H,9,10)/t3-/m0/s1 |
| InChIKey | ZDXPYRJPNDTMRX-VKHMYHEASA-N |
| XLogP | -1.34 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |