C17H11N5 — CID 3902
View drug profile → letrozole4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzonitrile (PubChem CID 3902) has the molecular formula C17H11N5 and a molecular weight of 285.31 g/mol. Its IUPAC name is 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzonitrile.
| Compound Name | 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 3902 |
| Molecular Formula | C17H11N5 |
| Molecular Weight | 285.31 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 4-[(4-cyanophenyl)-(1,2,4-triazol-1-yl)methyl]benzonitrile |
| SMILES | N#Cc1ccc(C(c2ccc(C#N)cc2)n2cncn2)cc1 |
| InChI | InChI=1S/C17H11N5/c18-9-13-1-5-15(6-2-13)17(22-12-20-11-21-22)16-7-3-14(10-19)4-8-16/h1-8,11-12,17H |
| InChIKey | HPJKCIUCZWXJDR-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |