2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid

C19H17NO5 — CID 4237

💊View drug profile → mofezolac
IUPAC2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid
SMILESCOc1ccc(-c2noc(CC(=O)O)c2-c2ccc(OC)cc2)cc1
InChIInChI=1S/C19H17NO5/c1-23-14-7-3-12(4-8-14)18-16(11-17(21)22)25-20-19(18)13-5-9-15(24-2)10-6-13/h3-10H,11H2,1-2H3,(H,21,22)
InChIKeyDJEIHHYCDCTAAH-UHFFFAOYSA-N
MW339.35 g/mol
LogP3.65
Rot. Bonds6

About 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid

2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid (PubChem CID 4237) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid.

Molecular Properties

Compound Name2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid
PubChem CID4237
Molecular FormulaC19H17NO5
Molecular Weight339.35 g/mol
Exact Mass339.11
IUPAC Name2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid
SMILESCOc1ccc(-c2noc(CC(=O)O)c2-c2ccc(OC)cc2)cc1
InChIInChI=1S/C19H17NO5/c1-23-14-7-3-12(4-8-14)18-16(11-17(21)22)25-20-19(18)13-5-9-15(24-2)10-6-13/h3-10H,11H2,1-2H3,(H,21,22)
InChIKeyDJEIHHYCDCTAAH-UHFFFAOYSA-N
XLogP3.65
TPSA81.79 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500339.35
LogP ≤ 53.65
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid?
The IUPAC name of 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid (CID 4237) is 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid.
What is the SMILES notation for 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid?
The canonical SMILES for 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid is COc1ccc(-c2noc(CC(=O)O)c2-c2ccc(OC)cc2)cc1.
What is the InChIKey of 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid?
The InChIKey is DJEIHHYCDCTAAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5/c1-23-14-7-3-12(4-8-14)18-16(11-17(21)22)25-20-19(18)13-5-9-15(24-2)10-6-13/h3-10H,11H2,1-2H3,(H,21,22).
What are the key properties of 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid?
2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid has a molecular weight of 339.35 g/mol, XLogP of 3.65, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid is sourced from PubChem (CID 4237), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).