C19H17NO5 — CID 4237
View drug profile → mofezolac2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid (PubChem CID 4237) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid.
| Compound Name | 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 4237 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 2-[3,4-bis(4-methoxyphenyl)-1,2-oxazol-5-yl]acetic acid |
| SMILES | COc1ccc(-c2noc(CC(=O)O)c2-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C19H17NO5/c1-23-14-7-3-12(4-8-14)18-16(11-17(21)22)25-20-19(18)13-5-9-15(24-2)10-6-13/h3-10H,11H2,1-2H3,(H,21,22) |
| InChIKey | DJEIHHYCDCTAAH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 81.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |