C15H13NO3 — CID 4888
View drug profile → pranoprofen2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid (PubChem CID 4888) has the molecular formula C15H13NO3 and a molecular weight of 255.27 g/mol. Its IUPAC name is 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid.
| Compound Name | 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid |
|---|---|
| PubChem CID | 4888 |
| Molecular Formula | C15H13NO3 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid |
| SMILES | CC(C(=O)O)c1ccc2c(c1)Cc1cccnc1O2 |
| InChI | InChI=1S/C15H13NO3/c1-9(15(17)18)10-4-5-13-12(7-10)8-11-3-2-6-16-14(11)19-13/h2-7,9H,8H2,1H3,(H,17,18) |
| InChIKey | TVQZAMVBTVNYLA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |