C9H6I3NO3 — CID 6806
View drug profile → acetrizoic acid3-acetamido-2,4,6-triiodobenzoic acid (PubChem CID 6806) has the molecular formula C9H6I3NO3 and a molecular weight of 556.86 g/mol. Its IUPAC name is 3-acetamido-2,4,6-triiodobenzoic acid.
| Compound Name | 3-acetamido-2,4,6-triiodobenzoic acid |
|---|---|
| PubChem CID | 6806 |
| Molecular Formula | C9H6I3NO3 |
| Molecular Weight | 556.86 g/mol |
| Exact Mass | 556.75 |
| IUPAC Name | 3-acetamido-2,4,6-triiodobenzoic acid |
| SMILES | CC(=O)Nc1c(I)cc(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C9H6I3NO3/c1-3(14)13-8-5(11)2-4(10)6(7(8)12)9(15)16/h2H,1H3,(H,13,14)(H,15,16) |
| InChIKey | GNOGSFBXBWBTIG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|