C23H29NO3 — CID 20395
View drug profile → fenbutrazate2-(3-methyl-2-phenylmorpholin-4-yl)ethyl 2-phenylbutanoate (PubChem CID 20395) has the molecular formula C23H29NO3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 2-(3-methyl-2-phenylmorpholin-4-yl)ethyl 2-phenylbutanoate.
| Compound Name | 2-(3-methyl-2-phenylmorpholin-4-yl)ethyl 2-phenylbutanoate |
|---|---|
| PubChem CID | 20395 |
| Molecular Formula | C23H29NO3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.21 |
| IUPAC Name | 2-(3-methyl-2-phenylmorpholin-4-yl)ethyl 2-phenylbutanoate |
| SMILES | CCC(C(=O)OCCN1CCOC(c2ccccc2)C1C)c1ccccc1 |
| InChI | InChI=1S/C23H29NO3/c1-3-21(19-10-6-4-7-11-19)23(25)27-17-15-24-14-16-26-22(18(24)2)20-12-8-5-9-13-20/h4-13,18,21-22H,3,14-17H2,1-2H3 |
| InChIKey | BAQKJENAVQLANS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |