About 10H-phenothiazine
10H-phenothiazine (PubChem CID 7108) has the molecular formula C12H9NS
and a molecular weight of 199.28 g/mol. Its IUPAC name is 10H-phenothiazine.
Molecular Properties
| Compound Name | 10H-phenothiazine |
| PubChem CID | 7108 |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | 10H-phenothiazine |
| SMILES | c1ccc2c(c1)Nc1ccccc1S2 |
| InChI | InChI=1S/C12H9NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H |
| InChIKey | WJFKNYWRSNBZNX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_666_A(13)', 'substructure': 'N/A'} |
|---|
Analyze 10H-phenothiazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10H-phenothiazine?
The IUPAC name of 10H-phenothiazine (CID 7108) is 10H-phenothiazine.
What is the SMILES notation for 10H-phenothiazine?
The canonical SMILES for 10H-phenothiazine is c1ccc2c(c1)Nc1ccccc1S2.
What is the InChIKey of 10H-phenothiazine?
The InChIKey is WJFKNYWRSNBZNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NS/c1-3-7-11-9(5-1)13-10-6-2-4-8-12(10)14-11/h1-8,13H.
What are the key properties of 10H-phenothiazine?
10H-phenothiazine has a molecular weight of 199.28 g/mol, XLogP of 3.89, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10H-phenothiazine is sourced from PubChem (CID 7108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).