C11H12N2O2 — CID 135436543
View drug profile → fenozolone2-ethylimino-5-phenyl-1,3-oxazolidin-4-one (PubChem CID 135436543) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-ethylimino-5-phenyl-1,3-oxazolidin-4-one.
| Compound Name | 2-ethylimino-5-phenyl-1,3-oxazolidin-4-one |
|---|---|
| PubChem CID | 135436543 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-ethylimino-5-phenyl-1,3-oxazolidin-4-one |
| SMILES | CC/N=C1/NC(=O)C(c2ccccc2)O1 |
| InChI | InChI=1S/C11H12N2O2/c1-2-12-11-13-10(14)9(15-11)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,12,13,14) |
| InChIKey | RXOIEVSUURELPG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|