About 2,4,6-trinitrophenol
2,4,6-trinitrophenol (PubChem CID 6954) has the molecular formula C6H3N3O7
and a molecular weight of 229.10 g/mol. Its IUPAC name is 2,4,6-trinitrophenol.
Molecular Properties
| Compound Name | 2,4,6-trinitrophenol |
| PubChem CID | 6954 |
| Molecular Formula | C6H3N3O7 |
| Molecular Weight | 229.10 g/mol |
| Exact Mass | 229.00 |
| IUPAC Name | 2,4,6-trinitrophenol |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H |
| InChIKey | OXNIZHLAWKMVMX-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 149.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.10 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,4,6-trinitrophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,6-trinitrophenol?
The IUPAC name of 2,4,6-trinitrophenol (CID 6954) is 2,4,6-trinitrophenol.
What is the SMILES notation for 2,4,6-trinitrophenol?
The canonical SMILES for 2,4,6-trinitrophenol is O=[N+]([O-])c1cc([N+](=O)[O-])c(O)c([N+](=O)[O-])c1.
What is the InChIKey of 2,4,6-trinitrophenol?
The InChIKey is OXNIZHLAWKMVMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O7/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h1-2,10H.
What are the key properties of 2,4,6-trinitrophenol?
2,4,6-trinitrophenol has a molecular weight of 229.10 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,6-trinitrophenol is sourced from PubChem (CID 6954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).