About 2-phenylphenol
2-phenylphenol (PubChem CID 7017) has the molecular formula C12H10O
and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-phenylphenol.
Molecular Properties
| Compound Name | 2-phenylphenol |
| PubChem CID | 7017 |
| Molecular Formula | C12H10O |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 2-phenylphenol |
| SMILES | Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H |
| InChIKey | LLEMOWNGBBNAJR-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylphenol?
The IUPAC name of 2-phenylphenol (CID 7017) is 2-phenylphenol.
What is the SMILES notation for 2-phenylphenol?
The canonical SMILES for 2-phenylphenol is Oc1ccccc1-c1ccccc1.
What is the InChIKey of 2-phenylphenol?
The InChIKey is LLEMOWNGBBNAJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,13H.
What are the key properties of 2-phenylphenol?
2-phenylphenol has a molecular weight of 170.21 g/mol, XLogP of 3.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylphenol is sourced from PubChem (CID 7017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).