C15H10O7 — CID 5280343
View drug profile → quercetin2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one (PubChem CID 5280343) has the molecular formula C15H10O7 and a molecular weight of 302.24 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
|---|---|
| PubChem CID | 5280343 |
| Molecular Formula | C15H10O7 |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3,5,7-trihydroxychromen-4-one |
| SMILES | O=c1c(O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| InChI | InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H |
| InChIKey | REFJWTPEDVJJIY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|