C30H32N2O14S5 — CID 8627
View drug profile → solasulfone1-phenyl-3-[4-[4-[(3-phenyl-1,3-disulfopropyl)amino]phenyl]sulfonylanilino]propane-1,3-disulfonic acid (PubChem CID 8627) has the molecular formula C30H32N2O14S5 and a molecular weight of 804.92 g/mol. Its IUPAC name is 1-phenyl-3-[4-[4-[(3-phenyl-1,3-disulfopropyl)amino]phenyl]sulfonylanilino]propane-1,3-disulfonic acid.
| Compound Name | 1-phenyl-3-[4-[4-[(3-phenyl-1,3-disulfopropyl)amino]phenyl]sulfonylanilino]propane-1,3-disulfonic acid |
|---|---|
| PubChem CID | 8627 |
| Molecular Formula | C30H32N2O14S5 |
| Molecular Weight | 804.92 g/mol |
| Exact Mass | 804.05 |
| IUPAC Name | 1-phenyl-3-[4-[4-[(3-phenyl-1,3-disulfopropyl)amino]phenyl]sulfonylanilino]propane-1,3-disulfonic acid |
| SMILES | O=S(=O)(c1ccc(NC(CC(c2ccccc2)S(=O)(=O)O)S(=O)(=O)O)cc1)c1ccc(NC(CC(c2ccccc2)S(=O)(=O)O)S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C30H32N2O14S5/c33-47(34,25-15-11-23(12-16-25)31-29(50(41,42)43)19-27(48(35,36)37)21-7-3-1-4-8-21)26-17-13-24(14-18-26)32-30(51(44,45)46)20-28(49(38,39)40)22-9-5-2-6-10-22/h1-18,27-32H,19-20H2,(H,35,36,37)(H,38,39,40)(H,41,42,43)(H,44,45,46) |
| InChIKey | HCCUQCPVNVAHMV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 275.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.92 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|