C7H8N4O2 — CID 5429
View drug profile → theobromine3,7-dimethylpurine-2,6-dione (PubChem CID 5429) has the molecular formula C7H8N4O2 and a molecular weight of 180.17 g/mol. Its IUPAC name is 3,7-dimethylpurine-2,6-dione.
| Compound Name | 3,7-dimethylpurine-2,6-dione |
|---|---|
| PubChem CID | 5429 |
| Molecular Formula | C7H8N4O2 |
| Molecular Weight | 180.17 g/mol |
| Exact Mass | 180.06 |
| IUPAC Name | 3,7-dimethylpurine-2,6-dione |
| SMILES | Cn1cnc2c1c(=O)[nH]c(=O)n2C |
| InChI | InChI=1S/C7H8N4O2/c1-10-3-8-5-4(10)6(12)9-7(13)11(5)2/h3H,1-2H3,(H,9,12,13) |
| InChIKey | YAPQBXQYLJRXSA-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 72.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.17 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |