C23H32N2O2S — CID 3001386
View drug profile → tiocarlide1,3-bis[4-(3-methylbutoxy)phenyl]thiourea (PubChem CID 3001386) has the molecular formula C23H32N2O2S and a molecular weight of 400.59 g/mol. Its IUPAC name is 1,3-bis[4-(3-methylbutoxy)phenyl]thiourea.
| Compound Name | 1,3-bis[4-(3-methylbutoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 3001386 |
| Molecular Formula | C23H32N2O2S |
| Molecular Weight | 400.59 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1,3-bis[4-(3-methylbutoxy)phenyl]thiourea |
| SMILES | CC(C)CCOc1ccc(NC(=S)Nc2ccc(OCCC(C)C)cc2)cc1 |
| InChI | InChI=1S/C23H32N2O2S/c1-17(2)13-15-26-21-9-5-19(6-10-21)24-23(28)25-20-7-11-22(12-8-20)27-16-14-18(3)4/h5-12,17-18H,13-16H2,1-4H3,(H2,24,25,28) |
| InChIKey | BWBONKHPVHMQHE-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.59 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|