About 2-benzyl-4,5-dihydro-1H-imidazole
2-benzyl-4,5-dihydro-1H-imidazole (PubChem CID 5504) has the molecular formula C10H12N2
and a molecular weight of 160.22 g/mol. Its IUPAC name is 2-benzyl-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 2-benzyl-4,5-dihydro-1H-imidazole |
| PubChem CID | 5504 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 2-benzyl-4,5-dihydro-1H-imidazole |
| SMILES | c1ccc(CC2=NCCN2)cc1 |
| InChI | InChI=1S/C10H12N2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5H,6-8H2,(H,11,12) |
| InChIKey | JIVZKJJQOZQXQB-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzyl-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-4,5-dihydro-1H-imidazole?
The IUPAC name of 2-benzyl-4,5-dihydro-1H-imidazole (CID 5504) is 2-benzyl-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 2-benzyl-4,5-dihydro-1H-imidazole?
The canonical SMILES for 2-benzyl-4,5-dihydro-1H-imidazole is c1ccc(CC2=NCCN2)cc1.
What is the InChIKey of 2-benzyl-4,5-dihydro-1H-imidazole?
The InChIKey is JIVZKJJQOZQXQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2/c1-2-4-9(5-3-1)8-10-11-6-7-12-10/h1-5H,6-8H2,(H,11,12).
What are the key properties of 2-benzyl-4,5-dihydro-1H-imidazole?
2-benzyl-4,5-dihydro-1H-imidazole has a molecular weight of 160.22 g/mol, XLogP of 1.23, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 5504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).