About 2-amino-4-arsorosophenol
2-amino-4-arsorosophenol (PubChem CID 10845) has the molecular formula C6H6AsNO2
and a molecular weight of 199.04 g/mol. Its IUPAC name is 2-amino-4-arsorosophenol.
Molecular Properties
| Compound Name | 2-amino-4-arsorosophenol |
| PubChem CID | 10845 |
| Molecular Formula | C6H6AsNO2 |
| Molecular Weight | 199.04 g/mol |
| Exact Mass | 198.96 |
| IUPAC Name | 2-amino-4-arsorosophenol |
| SMILES | Nc1cc([As]=O)ccc1O |
| InChI | InChI=1S/C6H6AsNO2/c8-5-3-4(7-10)1-2-6(5)9/h1-3,9H,8H2 |
| InChIKey | KVGGQNNGLOIZSK-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.04 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-4-arsorosophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-4-arsorosophenol?
The IUPAC name of 2-amino-4-arsorosophenol (CID 10845) is 2-amino-4-arsorosophenol.
What is the SMILES notation for 2-amino-4-arsorosophenol?
The canonical SMILES for 2-amino-4-arsorosophenol is Nc1cc([As]=O)ccc1O.
What is the InChIKey of 2-amino-4-arsorosophenol?
The InChIKey is KVGGQNNGLOIZSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6AsNO2/c8-5-3-4(7-10)1-2-6(5)9/h1-3,9H,8H2.
What are the key properties of 2-amino-4-arsorosophenol?
2-amino-4-arsorosophenol has a molecular weight of 199.04 g/mol, XLogP of -0.35, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-4-arsorosophenol is sourced from PubChem (CID 10845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).